C20H20N4O2 — CID 170922592
(3,4-dimethoxyphenyl)methyl-(4-methyl-6-phenylpyrimidin-2-yl)diazene (PubChem CID 170922592) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-(4-methyl-6-phenylpyrimidin-2-yl)diazene.
| Compound Name | (3,4-dimethoxyphenyl)methyl-(4-methyl-6-phenylpyrimidin-2-yl)diazene |
|---|---|
| PubChem CID | 170922592 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-(4-methyl-6-phenylpyrimidin-2-yl)diazene |
| SMILES | COc1ccc(C/N=N/c2nc(C)cc(-c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C20H20N4O2/c1-14-11-17(16-7-5-4-6-8-16)23-20(22-14)24-21-13-15-9-10-18(25-2)19(12-15)26-3/h4-12H,13H2,1-3H3/b24-21+ |
| InChIKey | GOVDAVVZONERKZ-DARPEHSRSA-N |
| XLogP | 4.75 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|