C14H12N6O3S — CID 170921680
[2-methoxy-4-[(2H-tetrazol-5-yldiazenyl)methyl]phenyl] thiophene-2-carboxylate (PubChem CID 170921680) has the molecular formula C14H12N6O3S and a molecular weight of 344.36 g/mol. Its IUPAC name is [2-methoxy-4-[(2H-tetrazol-5-yldiazenyl)methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-methoxy-4-[(2H-tetrazol-5-yldiazenyl)methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 170921680 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | [2-methoxy-4-[(2H-tetrazol-5-yldiazenyl)methyl]phenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C/N=N/c2nn[nH]n2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C14H12N6O3S/c1-22-11-7-9(8-15-16-14-17-19-20-18-14)4-5-10(11)23-13(21)12-3-2-6-24-12/h2-7H,8H2,1H3,(H,17,18,19,20)/b16-15+ |
| InChIKey | SUTATWQNRUIQFI-FOCLMDBBSA-N |
| XLogP | 2.77 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|