C25H27NO7S — CID 34257471
diethyl 4-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 34257471) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is diethyl 4-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 34257471 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | diethyl 4-[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1ccc(OC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C25H27NO7S/c1-6-31-24(28)20-14(3)26-15(4)21(25(29)32-7-2)22(20)16-10-11-17(18(13-16)30-5)33-23(27)19-9-8-12-34-19/h8-13,22,26H,6-7H2,1-5H3 |
| InChIKey | OCAXCLOWUUXLDO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|