C22H24N2O6S2 — CID 41300792
2-methoxyethyl (4R)-4-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 41300792) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-methoxyethyl (4R)-4-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl (4R)-4-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 41300792 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-methoxyethyl (4R)-4-[3-ethoxy-4-(thiophene-2-carbonyloxy)phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@H]2NC(=S)NC(C)=C2C(=O)OCCOC)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H24N2O6S2/c1-4-28-16-12-14(7-8-15(16)30-20(25)17-6-5-11-32-17)19-18(13(2)23-22(31)24-19)21(26)29-10-9-27-3/h5-8,11-12,19H,4,9-10H2,1-3H3,(H2,23,24,31)/t19-/m1/s1 |
| InChIKey | VBGYUSKTGZIWBI-LJQANCHMSA-N |
| XLogP | 3.35 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|