C14H16BrN3S — CID 23878040
N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N,N-diethylmethanimidamide (PubChem CID 23878040) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N,N-diethylmethanimidamide.
| Compound Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 23878040 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N'-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-N,N-diethylmethanimidamide |
| SMILES | CCN(C=Nc1nc(-c2ccc(Br)cc2)cs1)CC |
| InChI | InChI=1S/C14H16BrN3S/c1-3-18(4-2)10-16-14-17-13(9-19-14)11-5-7-12(15)8-6-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | RFCACLVOSLTORI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|