C21H20N4O3S2 — CID 123885283
4-[4-[2-[(4-methylsulfanylphenyl)methyldiazenyl]-1,3-thiazol-4-yl]anilino]-4-oxobutanoic acid (PubChem CID 123885283) has the molecular formula C21H20N4O3S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 4-[4-[2-[(4-methylsulfanylphenyl)methyldiazenyl]-1,3-thiazol-4-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[2-[(4-methylsulfanylphenyl)methyldiazenyl]-1,3-thiazol-4-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123885283 |
| Molecular Formula | C21H20N4O3S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 4-[4-[2-[(4-methylsulfanylphenyl)methyldiazenyl]-1,3-thiazol-4-yl]anilino]-4-oxobutanoic acid |
| SMILES | CSc1ccc(C/N=N/c2nc(-c3ccc(NC(=O)CCC(=O)O)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H20N4O3S2/c1-29-17-8-2-14(3-9-17)12-22-25-21-24-18(13-30-21)15-4-6-16(7-5-15)23-19(26)10-11-20(27)28/h2-9,13H,10-12H2,1H3,(H,23,26)(H,27,28)/b25-22+ |
| InChIKey | DGFPFRYEVRIBDB-YYDJUVGSSA-N |
| XLogP | 5.62 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|