C18H11BrCl2N4O4S — CID 118706434
(2Z)-3-(4-bromo-2-nitrophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid (PubChem CID 118706434) has the molecular formula C18H11BrCl2N4O4S and a molecular weight of 530.19 g/mol. Its IUPAC name is (2Z)-3-(4-bromo-2-nitrophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-3-(4-bromo-2-nitrophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 118706434 |
| Molecular Formula | C18H11BrCl2N4O4S |
| Molecular Weight | 530.19 g/mol |
| Exact Mass | 527.91 |
| IUPAC Name | (2Z)-3-(4-bromo-2-nitrophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
| SMILES | O=C(O)/C(Cc1ccc(Br)cc1[N+](=O)[O-])=N\Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C18H11BrCl2N4O4S/c19-11-3-1-10(16(7-11)25(28)29)6-14(17(26)27)23-24-18-22-15(8-30-18)9-2-4-12(20)13(21)5-9/h1-5,7-8H,6H2,(H,22,24)(H,26,27)/b23-14- |
| InChIKey | AOLBFWDOPPMSLX-UCQKPKSFSA-N |
| XLogP | 5.88 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.19 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|