C12H8Cl2N6O2S — CID 86689945
(2Z)-3-azido-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid (PubChem CID 86689945) has the molecular formula C12H8Cl2N6O2S and a molecular weight of 371.21 g/mol. Its IUPAC name is (2Z)-3-azido-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-3-azido-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 86689945 |
| Molecular Formula | C12H8Cl2N6O2S |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | (2Z)-3-azido-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
| SMILES | [N-]=[N+]=NC/C(=N/Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1)C(=O)O |
| InChI | InChI=1S/C12H8Cl2N6O2S/c13-7-2-1-6(3-8(7)14)10-5-23-12(17-10)19-18-9(11(21)22)4-16-20-15/h1-3,5H,4H2,(H,17,19)(H,21,22)/b18-9- |
| InChIKey | BOALEMNYKGMPAC-NVMNQCDNSA-N |
| XLogP | 4.28 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|