C18H14Cl2N4O2S — CID 118706349
(2E)-3-(4-aminophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid (PubChem CID 118706349) has the molecular formula C18H14Cl2N4O2S and a molecular weight of 421.31 g/mol. Its IUPAC name is (2E)-3-(4-aminophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid.
| Compound Name | (2E)-3-(4-aminophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 118706349 |
| Molecular Formula | C18H14Cl2N4O2S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | (2E)-3-(4-aminophenyl)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]propanoic acid |
| SMILES | Nc1ccc(C/C(=N\Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H14Cl2N4O2S/c19-13-6-3-11(8-14(13)20)16-9-27-18(22-16)24-23-15(17(25)26)7-10-1-4-12(21)5-2-10/h1-6,8-9H,7,21H2,(H,22,24)(H,25,26)/b23-15+ |
| InChIKey | AHKZQCUGPBKGDL-HZHRSRAPSA-N |
| XLogP | 4.79 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|