C18H13Cl2N3O2S — CID 11668606
(2E)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-3-phenylpropanoic acid (PubChem CID 11668606) has the molecular formula C18H13Cl2N3O2S and a molecular weight of 406.29 g/mol. Its IUPAC name is (2E)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-3-phenylpropanoic acid.
| Compound Name | (2E)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11668606 |
| Molecular Formula | C18H13Cl2N3O2S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | (2E)-2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-3-phenylpropanoic acid |
| SMILES | O=C(O)/C(Cc1ccccc1)=N/Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C18H13Cl2N3O2S/c19-13-7-6-12(9-14(13)20)16-10-26-18(21-16)23-22-15(17(24)25)8-11-4-2-1-3-5-11/h1-7,9-10H,8H2,(H,21,23)(H,24,25)/b22-15+ |
| InChIKey | KKDVWXLTHFPURR-PXLXIMEGSA-N |
| XLogP | 5.21 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|