C20H17N7O5S — CID 140611607
(2Z)-2-[[4-[4-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid (PubChem CID 140611607) has the molecular formula C20H17N7O5S and a molecular weight of 467.47 g/mol. Its IUPAC name is (2Z)-2-[[4-[4-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | (2Z)-2-[[4-[4-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 140611607 |
| Molecular Formula | C20H17N7O5S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (2Z)-2-[[4-[4-(2-azidoethoxy)phenyl]-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
| SMILES | [N-]=[N+]=NCCOc1ccc(-c2csc(N/N=C(/Cc3ccccc3[N+](=O)[O-])C(=O)O)n2)cc1 |
| InChI | InChI=1S/C20H17N7O5S/c21-26-22-9-10-32-15-7-5-13(6-8-15)17-12-33-20(23-17)25-24-16(19(28)29)11-14-3-1-2-4-18(14)27(30)31/h1-8,12H,9-11H2,(H,23,25)(H,28,29)/b24-16- |
| InChIKey | DJKNJIVFRKPPMZ-JLPGSUDCSA-N |
| XLogP | 4.50 |
| TPSA | 175.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|