C28H24ClN3O6S — CID 162137447
2-[[4-[4-[3-(4-chlorophenoxy)propoxy]phenyl]-1,3-thiazol-2-yl]methylimino]-3-(2-nitrophenyl)propanoic acid (PubChem CID 162137447) has the molecular formula C28H24ClN3O6S and a molecular weight of 566.04 g/mol. Its IUPAC name is 2-[[4-[4-[3-(4-chlorophenoxy)propoxy]phenyl]-1,3-thiazol-2-yl]methylimino]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | 2-[[4-[4-[3-(4-chlorophenoxy)propoxy]phenyl]-1,3-thiazol-2-yl]methylimino]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 162137447 |
| Molecular Formula | C28H24ClN3O6S |
| Molecular Weight | 566.04 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 2-[[4-[4-[3-(4-chlorophenoxy)propoxy]phenyl]-1,3-thiazol-2-yl]methylimino]-3-(2-nitrophenyl)propanoic acid |
| SMILES | O=C(O)/C(Cc1ccccc1[N+](=O)[O-])=N\Cc1nc(-c2ccc(OCCCOc3ccc(Cl)cc3)cc2)cs1 |
| InChI | InChI=1S/C28H24ClN3O6S/c29-21-8-12-23(13-9-21)38-15-3-14-37-22-10-6-19(7-11-22)25-18-39-27(31-25)17-30-24(28(33)34)16-20-4-1-2-5-26(20)32(35)36/h1-2,4-13,18H,3,14-17H2,(H,33,34)/b30-24- |
| InChIKey | ZJMBPXUETABTAN-KRUMMXJUSA-N |
| XLogP | 6.49 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.04 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|