C22H21N7O5S — CID 123542526
2-[[4-[4-(4-azidobutoxy)phenyl]-1,3-thiazol-2-yl]diazenyl]-3-(2-nitrophenyl)propanoic acid (PubChem CID 123542526) has the molecular formula C22H21N7O5S and a molecular weight of 495.52 g/mol. Its IUPAC name is 2-[[4-[4-(4-azidobutoxy)phenyl]-1,3-thiazol-2-yl]diazenyl]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | 2-[[4-[4-(4-azidobutoxy)phenyl]-1,3-thiazol-2-yl]diazenyl]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 123542526 |
| Molecular Formula | C22H21N7O5S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[[4-[4-(4-azidobutoxy)phenyl]-1,3-thiazol-2-yl]diazenyl]-3-(2-nitrophenyl)propanoic acid |
| SMILES | [N-]=[N+]=NCCCCOc1ccc(-c2csc(/N=N/C(Cc3ccccc3[N+](=O)[O-])C(=O)O)n2)cc1 |
| InChI | InChI=1S/C22H21N7O5S/c23-28-24-11-3-4-12-34-17-9-7-15(8-10-17)19-14-35-22(25-19)27-26-18(21(30)31)13-16-5-1-2-6-20(16)29(32)33/h1-2,5-10,14,18H,3-4,11-13H2,(H,30,31)/b27-26+ |
| InChIKey | VTISKDGFGWFQIQ-CYYJNZCTSA-N |
| XLogP | 5.97 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|