C16H11ClN4O4S — CID 123914904
2-[(5-chloro-1,3-benzothiazol-2-yl)diazenyl]-3-(2-nitrophenyl)propanoic acid (PubChem CID 123914904) has the molecular formula C16H11ClN4O4S and a molecular weight of 390.81 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)diazenyl]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)diazenyl]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 123914904 |
| Molecular Formula | C16H11ClN4O4S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)diazenyl]-3-(2-nitrophenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1[N+](=O)[O-])/N=N/c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H11ClN4O4S/c17-10-5-6-14-11(8-10)18-16(26-14)20-19-12(15(22)23)7-9-3-1-2-4-13(9)21(24)25/h1-6,8,12H,7H2,(H,22,23)/b20-19+ |
| InChIKey | HIEORFMCZCAFPU-FMQUCBEESA-N |
| XLogP | 4.64 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|