C14H11Cl2NO3 — CID 63017856
1-(3,5-dichlorophenyl)-2-(2-nitrophenyl)ethanol (PubChem CID 63017856) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(2-nitrophenyl)ethanol.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(2-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 63017856 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(2-nitrophenyl)ethanol |
| SMILES | O=[N+]([O-])c1ccccc1CC(O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3/c15-11-5-10(6-12(16)8-11)14(18)7-9-3-1-2-4-13(9)17(19)20/h1-6,8,14,18H,7H2 |
| InChIKey | FUVAEKNRQJCYEI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|