C14H10Cl3NO2 — CID 63519709
1,4-dichloro-2-[1-chloro-2-(2-nitrophenyl)ethyl]benzene (PubChem CID 63519709) has the molecular formula C14H10Cl3NO2 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1,4-dichloro-2-[1-chloro-2-(2-nitrophenyl)ethyl]benzene.
| Compound Name | 1,4-dichloro-2-[1-chloro-2-(2-nitrophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 63519709 |
| Molecular Formula | C14H10Cl3NO2 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 1,4-dichloro-2-[1-chloro-2-(2-nitrophenyl)ethyl]benzene |
| SMILES | O=[N+]([O-])c1ccccc1CC(Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H10Cl3NO2/c15-10-5-6-12(16)11(8-10)13(17)7-9-3-1-2-4-14(9)18(19)20/h1-6,8,13H,7H2 |
| InChIKey | PZAWTRGEBOPMOY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|