C20H14N4O5S — CID 56689411
(2Z)-2-[[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid (PubChem CID 56689411) has the molecular formula C20H14N4O5S and a molecular weight of 422.42 g/mol. Its IUPAC name is (2Z)-2-[[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | (2Z)-2-[[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 56689411 |
| Molecular Formula | C20H14N4O5S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | (2Z)-2-[[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
| SMILES | O=C(O)/C(Cc1ccccc1[N+](=O)[O-])=N\Nc1nc(-c2cc3ccccc3o2)cs1 |
| InChI | InChI=1S/C20H14N4O5S/c25-19(26)14(9-12-5-1-3-7-16(12)24(27)28)22-23-20-21-15(11-30-20)18-10-13-6-2-4-8-17(13)29-18/h1-8,10-11H,9H2,(H,21,23)(H,25,26)/b22-14- |
| InChIKey | DZZFKLHPLMXRBH-HMAPJEAMSA-N |
| XLogP | 4.56 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|