C19H12Cl2N4O5S — CID 87278522
(2Z)-2-[(7,8-dichloro-4H-chromeno[4,3-d][1,3]thiazol-2-yl)hydrazinylidene]-3-(2-nitrophenyl)propanoic acid (PubChem CID 87278522) has the molecular formula C19H12Cl2N4O5S and a molecular weight of 479.30 g/mol. Its IUPAC name is (2Z)-2-[(7,8-dichloro-4H-chromeno[4,3-d][1,3]thiazol-2-yl)hydrazinylidene]-3-(2-nitrophenyl)propanoic acid.
| Compound Name | (2Z)-2-[(7,8-dichloro-4H-chromeno[4,3-d][1,3]thiazol-2-yl)hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 87278522 |
| Molecular Formula | C19H12Cl2N4O5S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | (2Z)-2-[(7,8-dichloro-4H-chromeno[4,3-d][1,3]thiazol-2-yl)hydrazinylidene]-3-(2-nitrophenyl)propanoic acid |
| SMILES | O=C(O)/C(Cc1ccccc1[N+](=O)[O-])=N\Nc1nc2c(s1)COc1cc(Cl)c(Cl)cc1-2 |
| InChI | InChI=1S/C19H12Cl2N4O5S/c20-11-6-10-15(7-12(11)21)30-8-16-17(10)22-19(31-16)24-23-13(18(26)27)5-9-3-1-2-4-14(9)25(28)29/h1-4,6-7H,5,8H2,(H,22,24)(H,26,27)/b23-13- |
| InChIKey | KOZBTIDUIKQFSM-QRVIBDJDSA-N |
| XLogP | 5.01 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|