C20H19N3O4S2 — CID 27873181
5-methylsulfanyl-2-nitro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 27873181) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-methylsulfanyl-2-nitro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 5-methylsulfanyl-2-nitro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 27873181 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 5-methylsulfanyl-2-nitro-N-[4-(4-propoxyphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)c3cc(SC)ccc3[N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-3-10-27-14-6-4-13(5-7-14)17-12-29-20(21-17)22-19(24)16-11-15(28-2)8-9-18(16)23(25)26/h4-9,11-12H,3,10H2,1-2H3,(H,21,22,24) |
| InChIKey | HEFSZEVWUCWADI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|