C21H21N3O6S2 — CID 55466944
5-methoxy-4-(2-methoxyethoxy)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide (PubChem CID 55466944) has the molecular formula C21H21N3O6S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 5-methoxy-4-(2-methoxyethoxy)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide.
| Compound Name | 5-methoxy-4-(2-methoxyethoxy)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 55466944 |
| Molecular Formula | C21H21N3O6S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 5-methoxy-4-(2-methoxyethoxy)-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2nc(-c3ccc(SC)cc3)cs2)cc1OC |
| InChI | InChI=1S/C21H21N3O6S2/c1-28-8-9-30-19-11-17(24(26)27)15(10-18(19)29-2)20(25)23-21-22-16(12-32-21)13-4-6-14(31-3)7-5-13/h4-7,10-12H,8-9H2,1-3H3,(H,22,23,25) |
| InChIKey | URCIQKIBCSTHFF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|