C21H20ClN3O6S — CID 55466696
N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide (PubChem CID 55466696) has the molecular formula C21H20ClN3O6S and a molecular weight of 477.93 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
|---|---|
| PubChem CID | 55466696 |
| Molecular Formula | C21H20ClN3O6S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-5-methoxy-4-(2-methoxyethoxy)-2-nitrobenzamide |
| SMILES | COCCOc1cc([N+](=O)[O-])c(C(=O)Nc2nc(-c3ccc(Cl)cc3)c(C)s2)cc1OC |
| InChI | InChI=1S/C21H20ClN3O6S/c1-12-19(13-4-6-14(22)7-5-13)23-21(32-12)24-20(26)15-10-17(30-3)18(31-9-8-29-2)11-16(15)25(27)28/h4-7,10-11H,8-9H2,1-3H3,(H,23,24,26) |
| InChIKey | ZNQBPXOTMVYRDN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|