C17H13ClN6O2S — CID 155144510
2-chloro-N'-[(E)-N'-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamimidoyl]benzenecarboximidamide (PubChem CID 155144510) has the molecular formula C17H13ClN6O2S and a molecular weight of 400.85 g/mol. Its IUPAC name is 2-chloro-N'-[(E)-N'-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamimidoyl]benzenecarboximidamide.
| Compound Name | 2-chloro-N'-[(E)-N'-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 155144510 |
| Molecular Formula | C17H13ClN6O2S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-chloro-N'-[(E)-N'-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamimidoyl]benzenecarboximidamide |
| SMILES | N/C(=N\C(N)=N\c1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN6O2S/c18-13-7-2-1-6-12(13)15(19)22-16(20)23-17-21-14(9-27-17)10-4-3-5-11(8-10)24(25)26/h1-9H,(H4,19,20,21,22,23) |
| InChIKey | YWTHQPVECYVOCP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|