C18H18N3O4S- — CID 135720683
2-[(E)-[4-[3-(dihydroxyamino)phenyl]-1,3-thiazol-2-yl]iminomethyl]-5,5-dimethyl-3-oxocyclohexen-1-olate (PubChem CID 135720683) has the molecular formula C18H18N3O4S- and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[(E)-[4-[3-(dihydroxyamino)phenyl]-1,3-thiazol-2-yl]iminomethyl]-5,5-dimethyl-3-oxocyclohexen-1-olate.
| Compound Name | 2-[(E)-[4-[3-(dihydroxyamino)phenyl]-1,3-thiazol-2-yl]iminomethyl]-5,5-dimethyl-3-oxocyclohexen-1-olate |
|---|---|
| PubChem CID | 135720683 |
| Molecular Formula | C18H18N3O4S- |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[(E)-[4-[3-(dihydroxyamino)phenyl]-1,3-thiazol-2-yl]iminomethyl]-5,5-dimethyl-3-oxocyclohexen-1-olate |
| SMILES | CC1(C)CC(=O)C(/C=N/c2nc(-c3cccc(N(O)O)c3)cs2)=C([O-])C1 |
| InChI | InChI=1S/C18H19N3O4S/c1-18(2)7-15(22)13(16(23)8-18)9-19-17-20-14(10-26-17)11-4-3-5-12(6-11)21(24)25/h3-6,9-10,22,24-25H,7-8H2,1-2H3/p-1/b19-9+ |
| InChIKey | LXZHUAPPWQRHFN-DJKKODMXSA-M |
| XLogP | 3.10 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|