C16H11N3O5S — CID 5137408
4-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 5137408) has the molecular formula C16H11N3O5S and a molecular weight of 357.35 g/mol. Its IUPAC name is 4-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 5137408 |
| Molecular Formula | C16H11N3O5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-[2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(O)c(C=Nc2nc(-c3ccc(O)cc3O)cs2)c1 |
| InChI | InChI=1S/C16H11N3O5S/c20-11-2-3-12(15(22)6-11)13-8-25-16(18-13)17-7-9-5-10(19(23)24)1-4-14(9)21/h1-8,20-22H |
| InChIKey | YWYMMFCLFDETEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|