C14H9N3O3S — CID 23967821
1-(5-nitrofuran-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)methanimine (PubChem CID 23967821) has the molecular formula C14H9N3O3S and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(5-nitrofuran-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)methanimine.
| Compound Name | 1-(5-nitrofuran-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 23967821 |
| Molecular Formula | C14H9N3O3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-(5-nitrofuran-2-yl)-N-(4-phenyl-1,3-thiazol-2-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc(C=Nc2nc(-c3ccccc3)cs2)o1 |
| InChI | InChI=1S/C14H9N3O3S/c18-17(19)13-7-6-11(20-13)8-15-14-16-12(9-21-14)10-4-2-1-3-5-10/h1-9H |
| InChIKey | BNYNMNBTGHRFAW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|