C8H5N5O5 — CID 4141355
3-[(5-nitrofuran-2-yl)methylideneamino]-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 4141355) has the molecular formula C8H5N5O5 and a molecular weight of 251.16 g/mol. Its IUPAC name is 3-[(5-nitrofuran-2-yl)methylideneamino]-1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 4141355 |
| Molecular Formula | C8H5N5O5 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3-[(5-nitrofuran-2-yl)methylideneamino]-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | O=C(O)c1nc(N=Cc2ccc([N+](=O)[O-])o2)n[nH]1 |
| InChI | InChI=1S/C8H5N5O5/c14-7(15)6-10-8(12-11-6)9-3-4-1-2-5(18-4)13(16)17/h1-3H,(H,14,15)(H,10,11,12) |
| InChIKey | XCHNQIOHTMOSAH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|