C8H6N6O5 — CID 6299832
6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 6299832) has the molecular formula C8H6N6O5 and a molecular weight of 266.17 g/mol. Its IUPAC name is 6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 6299832 |
| Molecular Formula | C8H6N6O5 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N/N=C\c2ccc([N+](=O)[O-])o2)c(=O)[nH]1 |
| InChI | InChI=1S/C8H6N6O5/c15-7-6(12-13-8(16)10-7)11-9-3-4-1-2-5(19-4)14(17)18/h1-3H,(H,11,12)(H2,10,13,15,16)/b9-3- |
| InChIKey | KPWPYRCOBVLROF-OQFOIZHKSA-N |
| XLogP | -0.59 |
| TPSA | 159.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|