C11H11N5O5 — CID 6273750
1,3-dimethyl-6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidine-2,4-dione (PubChem CID 6273750) has the molecular formula C11H11N5O5 and a molecular weight of 293.24 g/mol. Its IUPAC name is 1,3-dimethyl-6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6273750 |
| Molecular Formula | C11H11N5O5 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1,3-dimethyl-6-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]pyrimidine-2,4-dione |
| SMILES | Cn1c(N/N=C\c2ccc([N+](=O)[O-])o2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C11H11N5O5/c1-14-8(5-9(17)15(2)11(14)18)13-12-6-7-3-4-10(21-7)16(19)20/h3-6,13H,1-2H3/b12-6- |
| InChIKey | XQQXZBFFXSIVDC-SDQBBNPISA-N |
| XLogP | 0.03 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|