C10H7N7O3 — CID 4702631
N-[(5-nitrofuran-2-yl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 4702631) has the molecular formula C10H7N7O3 and a molecular weight of 273.21 g/mol. Its IUPAC name is N-[(5-nitrofuran-2-yl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[(5-nitrofuran-2-yl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 4702631 |
| Molecular Formula | C10H7N7O3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[(5-nitrofuran-2-yl)methylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2ccc3nncn3n2)o1 |
| InChI | InChI=1S/C10H7N7O3/c18-17(19)10-4-1-7(20-10)5-11-13-8-2-3-9-14-12-6-16(9)15-8/h1-6H,(H,13,15) |
| InChIKey | XNXGRRLFFPIEMX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|