C14H15N7O3 — CID 134117140
6-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 134117140) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 6-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134117140 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 6-[(E)-(5-nitrofuran-2-yl)methylideneamino]-4-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCN(CC=C)c1nc(N)nc(/N=C/c2ccc([N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C14H15N7O3/c1-3-7-20(8-4-2)14-18-12(15)17-13(19-14)16-9-10-5-6-11(24-10)21(22)23/h3-6,9H,1-2,7-8H2,(H2,15,17,18,19)/b16-9+ |
| InChIKey | XJDKTGATEUYEBP-CXUHLZMHSA-N |
| XLogP | 1.88 |
| TPSA | 136.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|