C15H11N5O5 — CID 54611520
2-acetyl-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-phenyl-1,2,4-triazol-3-one (PubChem CID 54611520) has the molecular formula C15H11N5O5 and a molecular weight of 341.28 g/mol. Its IUPAC name is 2-acetyl-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-phenyl-1,2,4-triazol-3-one.
| Compound Name | 2-acetyl-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 54611520 |
| Molecular Formula | C15H11N5O5 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-acetyl-4-[(E)-(5-nitrofuran-2-yl)methylideneamino]-5-phenyl-1,2,4-triazol-3-one |
| SMILES | CC(=O)n1nc(-c2ccccc2)n(/N=C/c2ccc([N+](=O)[O-])o2)c1=O |
| InChI | InChI=1S/C15H11N5O5/c1-10(21)18-15(22)19(14(17-18)11-5-3-2-4-6-11)16-9-12-7-8-13(25-12)20(23)24/h2-9H,1H3/b16-9+ |
| InChIKey | GWMZOONGOAXEDY-CXUHLZMHSA-N |
| XLogP | 1.76 |
| TPSA | 125.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|