C23H15N5O3S — CID 176513821
5-nitro-3-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]diazenyl]-1H-indol-2-ol (PubChem CID 176513821) has the molecular formula C23H15N5O3S and a molecular weight of 441.47 g/mol. Its IUPAC name is 5-nitro-3-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]diazenyl]-1H-indol-2-ol.
| Compound Name | 5-nitro-3-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 176513821 |
| Molecular Formula | C23H15N5O3S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 5-nitro-3-[[4-(4-phenylphenyl)-1,3-thiazol-2-yl]diazenyl]-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(O)c(/N=N/c3nc(-c4ccc(-c5ccccc5)cc4)cs3)c2c1 |
| InChI | InChI=1S/C23H15N5O3S/c29-22-21(18-12-17(28(30)31)10-11-19(18)24-22)26-27-23-25-20(13-32-23)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13,24,29H/b27-26+ |
| InChIKey | FTYQKSPQUWAEQN-CYYJNZCTSA-N |
| XLogP | 6.99 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|