C17H9F2N5O3S — CID 176513919
3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]diazenyl]-5-nitro-1H-indol-2-ol (PubChem CID 176513919) has the molecular formula C17H9F2N5O3S and a molecular weight of 401.35 g/mol. Its IUPAC name is 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]diazenyl]-5-nitro-1H-indol-2-ol.
| Compound Name | 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]diazenyl]-5-nitro-1H-indol-2-ol |
|---|---|
| PubChem CID | 176513919 |
| Molecular Formula | C17H9F2N5O3S |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]diazenyl]-5-nitro-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(O)c(/N=N/c3nc(-c4ccc(F)cc4F)cs3)c2c1 |
| InChI | InChI=1S/C17H9F2N5O3S/c18-8-1-3-10(12(19)5-8)14-7-28-17(21-14)23-22-15-11-6-9(24(26)27)2-4-13(11)20-16(15)25/h1-7,20,25H/b23-22+ |
| InChIKey | QBYCZPKFRHWHCL-GHVJWSGMSA-N |
| XLogP | 5.60 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|