C13H7N9O5 — CID 135448106
3-[(2-hydroxy-5-nitro-1H-indol-3-yl)diazenyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione (PubChem CID 135448106) has the molecular formula C13H7N9O5 and a molecular weight of 369.26 g/mol. Its IUPAC name is 3-[(2-hydroxy-5-nitro-1H-indol-3-yl)diazenyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione.
| Compound Name | 3-[(2-hydroxy-5-nitro-1H-indol-3-yl)diazenyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 135448106 |
| Molecular Formula | C13H7N9O5 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-[(2-hydroxy-5-nitro-1H-indol-3-yl)diazenyl]-5H-pyrimido[4,5-e][1,2,4]triazine-6,8-dione |
| SMILES | O=c1[nH]c(=O)c2nnc(/N=N/c3c(O)[nH]c4ccc([N+](=O)[O-])cc34)nc2[nH]1 |
| InChI | InChI=1S/C13H7N9O5/c23-10-7(5-3-4(22(26)27)1-2-6(5)14-10)18-20-12-15-9-8(19-21-12)11(24)17-13(25)16-9/h1-3,14,23H,(H2,15,16,17,21,24,25)/b20-18+ |
| InChIKey | GFDLPWBNWBHZBF-CZIZESTLSA-N |
| XLogP | 0.91 |
| TPSA | 208.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|