C9H8N5O3S+ — CID 91932643
[amino(sulfanyl)methylidene]-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]azanium (PubChem CID 91932643) has the molecular formula C9H8N5O3S+ and a molecular weight of 266.26 g/mol. Its IUPAC name is [amino(sulfanyl)methylidene]-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]azanium.
| Compound Name | [amino(sulfanyl)methylidene]-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]azanium |
|---|---|
| PubChem CID | 91932643 |
| Molecular Formula | C9H8N5O3S+ |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | [amino(sulfanyl)methylidene]-[(2-hydroxy-5-nitro-1H-indol-3-yl)imino]azanium |
| SMILES | NC(S)=[N+]=Nc1c(O)[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C9H7N5O3S/c10-9(18)13-12-7-5-3-4(14(16)17)1-2-6(5)11-8(7)15/h1-3H,(H4,10,11,12,13,15,18)/p+1 |
| InChIKey | POZADHUWCGYGHA-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|