C19H14N2O4S — CID 146091654
3-[4-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 146091654) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-[4-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 3-[4-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 146091654 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 3-[4-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nc(-c3ccc(N4CCOC4=O)cc3)cs2)c1 |
| InChI | InChI=1S/C19H14N2O4S/c22-18(23)14-3-1-2-13(10-14)17-20-16(11-26-17)12-4-6-15(7-5-12)21-8-9-25-19(21)24/h1-7,10-11H,8-9H2,(H,22,23) |
| InChIKey | LSAFJMJQZFSUHE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |