C21H19BrN2O3S — CID 163817113
4-bromo-2-[[4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]iminomethyl]phenol (PubChem CID 163817113) has the molecular formula C21H19BrN2O3S and a molecular weight of 459.37 g/mol. Its IUPAC name is 4-bromo-2-[[4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]iminomethyl]phenol.
| Compound Name | 4-bromo-2-[[4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 163817113 |
| Molecular Formula | C21H19BrN2O3S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 4-bromo-2-[[4-(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]iminomethyl]phenol |
| SMILES | COc1cc(-c2csc(N=Cc3cc(Br)ccc3O)n2)cc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C21H19BrN2O3S/c1-21(2)9-13-6-12(8-18(26-3)19(13)27-21)16-11-28-20(24-16)23-10-14-7-15(22)4-5-17(14)25/h4-8,10-11,25H,9H2,1-3H3 |
| InChIKey | NSHJRZRFSNRBKQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|