C18H20Cl2N2O3S — CID 141367023
2,2-dichloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 141367023) has the molecular formula C18H20Cl2N2O3S and a molecular weight of 415.34 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 141367023 |
| Molecular Formula | C18H20Cl2N2O3S |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2,2-dichloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCOc1cc(-c2csc(NC(=O)C(Cl)Cl)n2)cc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C18H20Cl2N2O3S/c1-4-5-24-13-7-10(6-11-8-18(2,3)25-14(11)13)12-9-26-17(21-12)22-16(23)15(19)20/h6-7,9,15H,4-5,8H2,1-3H3,(H,21,22,23) |
| InChIKey | BUKKAUXENBWVNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|