C19H23ClN2O3S — CID 141366986
2-chloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-5-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 141366986) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-5-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-5-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 141366986 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-chloro-N-[4-(2,2-dimethyl-7-propoxy-3H-1-benzofuran-5-yl)-5-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCOc1cc(-c2nc(NC(=O)CCl)sc2C)cc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C19H23ClN2O3S/c1-5-6-24-14-8-12(7-13-9-19(3,4)25-17(13)14)16-11(2)26-18(22-16)21-15(23)10-20/h7-8H,5-6,9-10H2,1-4H3,(H,21,22,23) |
| InChIKey | QPFHXFOLFUYCLK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|