C17H15BrN2O4S — CID 135607086
4-bromo-2-[(E)-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135607086) has the molecular formula C17H15BrN2O4S and a molecular weight of 423.29 g/mol. Its IUPAC name is 4-bromo-2-[(E)-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 4-bromo-2-[(E)-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135607086 |
| Molecular Formula | C17H15BrN2O4S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 4-bromo-2-[(E)-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1cc2nc(/N=C/c3cc(Br)ccc3O)sc2c(OC)c1OC |
| InChI | InChI=1S/C17H15BrN2O4S/c1-22-13-7-11-16(15(24-3)14(13)23-2)25-17(20-11)19-8-9-6-10(18)4-5-12(9)21/h4-8,21H,1-3H3/b19-8+ |
| InChIKey | GCSLZWXWLFLSNX-UFWORHAWSA-N |
| XLogP | 4.54 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|