C9H6BrN3OS2 — CID 135716914
5-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 135716914) has the molecular formula C9H6BrN3OS2 and a molecular weight of 316.21 g/mol. Its IUPAC name is 5-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 135716914 |
| Molecular Formula | C9H6BrN3OS2 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 314.91 |
| IUPAC Name | 5-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Oc1ccc(Br)cc1/C=N/c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C9H6BrN3OS2/c10-6-1-2-7(14)5(3-6)4-11-8-12-13-9(15)16-8/h1-4,14H,(H,13,15)/b11-4+ |
| InChIKey | PJIMAAXBCWUBGP-NYYWCZLTSA-N |
| XLogP | 3.42 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|