C11H9BrN4O2S3 — CID 137199510
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 137199510) has the molecular formula C11H9BrN4O2S3 and a molecular weight of 405.32 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 137199510 |
| Molecular Formula | C11H9BrN4O2S3 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(=S)s1)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C11H9BrN4O2S3/c12-7-1-2-8(17)6(3-7)4-13-14-9(18)5-20-11-16-15-10(19)21-11/h1-4,17H,5H2,(H,14,18)(H,15,19) |
| InChIKey | KCGGZRCWSIMOLB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|