C16H12Br2N2O2S — CID 135411971
3,4-dibromo-6-methoxy-2-[(E)-(6-methyl-1,3-benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135411971) has the molecular formula C16H12Br2N2O2S and a molecular weight of 456.16 g/mol. Its IUPAC name is 3,4-dibromo-6-methoxy-2-[(E)-(6-methyl-1,3-benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 3,4-dibromo-6-methoxy-2-[(E)-(6-methyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135411971 |
| Molecular Formula | C16H12Br2N2O2S |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.90 |
| IUPAC Name | 3,4-dibromo-6-methoxy-2-[(E)-(6-methyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2nc3ccc(C)cc3s2)c1O |
| InChI | InChI=1S/C16H12Br2N2O2S/c1-8-3-4-11-13(5-8)23-16(20-11)19-7-9-14(18)10(17)6-12(22-2)15(9)21/h3-7,21H,1-2H3/b19-7+ |
| InChIKey | ZFBTYAVVUMFYIB-FBCYGCLPSA-N |
| XLogP | 5.59 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|