C15H11Br2N3O3 — CID 4600415
5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 4600415) has the molecular formula C15H11Br2N3O3 and a molecular weight of 441.08 g/mol. Its IUPAC name is 5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 4600415 |
| Molecular Formula | C15H11Br2N3O3 |
| Molecular Weight | 441.08 g/mol |
| Exact Mass | 438.92 |
| IUPAC Name | 5-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2ccc3[nH]c(=O)[nH]c3c2)c1O |
| InChI | InChI=1S/C15H11Br2N3O3/c1-23-12-5-9(16)13(17)8(14(12)21)6-18-7-2-3-10-11(4-7)20-15(22)19-10/h2-6,21H,1H3,(H2,19,20,22)/b18-6+ |
| InChIKey | IFGPRLKBEQJZAK-NGYBGAFCSA-N |
| XLogP | 3.85 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.08 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|