C18H19Br2NO3 — CID 3984239
3,4-dibromo-2-[(4-tert-butyl-2-hydroxyphenyl)iminomethyl]-6-methoxyphenol (PubChem CID 3984239) has the molecular formula C18H19Br2NO3 and a molecular weight of 457.16 g/mol. Its IUPAC name is 3,4-dibromo-2-[(4-tert-butyl-2-hydroxyphenyl)iminomethyl]-6-methoxyphenol.
| Compound Name | 3,4-dibromo-2-[(4-tert-butyl-2-hydroxyphenyl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 3984239 |
| Molecular Formula | C18H19Br2NO3 |
| Molecular Weight | 457.16 g/mol |
| Exact Mass | 454.97 |
| IUPAC Name | 3,4-dibromo-2-[(4-tert-butyl-2-hydroxyphenyl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2ccc(C(C)(C)C)cc2O)c1O |
| InChI | InChI=1S/C18H19Br2NO3/c1-18(2,3)10-5-6-13(14(22)7-10)21-9-11-16(20)12(19)8-15(24-4)17(11)23/h5-9,22-23H,1-4H3/b21-9+ |
| InChIKey | NHYPDDGVOXLSMD-ZVBGSRNCSA-N |
| XLogP | 5.68 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.16 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|