C20H16Br2N2O2 — CID 171981143
2-[(4-anilinophenyl)iminomethyl]-3,4-dibromo-6-methoxyphenol (PubChem CID 171981143) has the molecular formula C20H16Br2N2O2 and a molecular weight of 476.17 g/mol. Its IUPAC name is 2-[(4-anilinophenyl)iminomethyl]-3,4-dibromo-6-methoxyphenol.
| Compound Name | 2-[(4-anilinophenyl)iminomethyl]-3,4-dibromo-6-methoxyphenol |
|---|---|
| PubChem CID | 171981143 |
| Molecular Formula | C20H16Br2N2O2 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | 2-[(4-anilinophenyl)iminomethyl]-3,4-dibromo-6-methoxyphenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2ccc(Nc3ccccc3)cc2)c1O |
| InChI | InChI=1S/C20H16Br2N2O2/c1-26-18-11-17(21)19(22)16(20(18)25)12-23-13-7-9-15(10-8-13)24-14-5-3-2-4-6-14/h2-12,24-25H,1H3/b23-12+ |
| InChIKey | RXPPBVSPNCHXBU-FSJBWODESA-N |
| XLogP | 6.42 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|