C21H15Br3N2O3 — CID 3717476
2-bromo-N-[3-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]benzamide (PubChem CID 3717476) has the molecular formula C21H15Br3N2O3 and a molecular weight of 583.07 g/mol. Its IUPAC name is 2-bromo-N-[3-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]benzamide.
| Compound Name | 2-bromo-N-[3-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]benzamide |
|---|---|
| PubChem CID | 3717476 |
| Molecular Formula | C21H15Br3N2O3 |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 579.86 |
| IUPAC Name | 2-bromo-N-[3-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]benzamide |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2cccc(NC(=O)c3ccccc3Br)c2)c1O |
| InChI | InChI=1S/C21H15Br3N2O3/c1-29-18-10-17(23)19(24)15(20(18)27)11-25-12-5-4-6-13(9-12)26-21(28)14-7-2-3-8-16(14)22/h2-11,27H,1H3,(H,26,28)/b25-11+ |
| InChIKey | BPYAQJOKAIULHI-OPEKNORGSA-N |
| XLogP | 6.69 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|