C21H15Br2IN2O3 — CID 3342367
N-[4-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]-4-iodobenzamide (PubChem CID 3342367) has the molecular formula C21H15Br2IN2O3 and a molecular weight of 630.07 g/mol. Its IUPAC name is N-[4-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]-4-iodobenzamide.
| Compound Name | N-[4-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 3342367 |
| Molecular Formula | C21H15Br2IN2O3 |
| Molecular Weight | 630.07 g/mol |
| Exact Mass | 627.85 |
| IUPAC Name | N-[4-[(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]phenyl]-4-iodobenzamide |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2ccc(NC(=O)c3ccc(I)cc3)cc2)c1O |
| InChI | InChI=1S/C21H15Br2IN2O3/c1-29-18-10-17(22)19(23)16(20(18)27)11-25-14-6-8-15(9-7-14)26-21(28)12-2-4-13(24)5-3-12/h2-11,27H,1H3,(H,26,28)/b25-11+ |
| InChIKey | BRYTUGSGSCHWKA-OPEKNORGSA-N |
| XLogP | 6.53 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.07 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|