C13H9Br2IN2O2 — CID 3419440
3,4-dibromo-2-[(5-iodo-2-pyridinyl)iminomethyl]-6-methoxyphenol (PubChem CID 3419440) has the molecular formula C13H9Br2IN2O2 and a molecular weight of 511.94 g/mol. Its IUPAC name is 3,4-dibromo-2-[(5-iodo-2-pyridinyl)iminomethyl]-6-methoxyphenol.
| Compound Name | 3,4-dibromo-2-[(5-iodo-2-pyridinyl)iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 3419440 |
| Molecular Formula | C13H9Br2IN2O2 |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 509.81 |
| IUPAC Name | 3,4-dibromo-2-[(5-iodo-2-pyridinyl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(Br)c(Br)c(/C=N/c2ccc(I)cn2)c1O |
| InChI | InChI=1S/C13H9Br2IN2O2/c1-20-10-4-9(14)12(15)8(13(10)19)6-18-11-3-2-7(16)5-17-11/h2-6,19H,1H3/b18-6+ |
| InChIKey | BSUFQDKAXGABQU-NGYBGAFCSA-N |
| XLogP | 4.68 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|