C14H9Br2Cl3N2O2 — CID 3662486
3,4-dibromo-6-methoxy-2-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol (PubChem CID 3662486) has the molecular formula C14H9Br2Cl3N2O2 and a molecular weight of 503.41 g/mol. Its IUPAC name is 3,4-dibromo-6-methoxy-2-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 3,4-dibromo-6-methoxy-2-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3662486 |
| Molecular Formula | C14H9Br2Cl3N2O2 |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 499.81 |
| IUPAC Name | 3,4-dibromo-6-methoxy-2-[[(2,4,6-trichlorophenyl)hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(Br)c(Br)c(C=NNc2c(Cl)cc(Cl)cc2Cl)c1O |
| InChI | InChI=1S/C14H9Br2Cl3N2O2/c1-23-11-4-8(15)12(16)7(14(11)22)5-20-21-13-9(18)2-6(17)3-10(13)19/h2-5,21-22H,1H3 |
| InChIKey | NNRBPMDUHHEAIK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|